C16H12BrCl2NO — CID 1325728
(E)-N-(4-bromo-2-methylphenyl)-3-(2,4-dichlorophenyl)prop-2-enamide (PubChem CID 1325728) has the molecular formula C16H12BrCl2NO and a molecular weight of 385.09 g/mol. Its IUPAC name is (E)-N-(4-bromo-2-methylphenyl)-3-(2,4-dichlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-(4-bromo-2-methylphenyl)-3-(2,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 1325728 |
| Molecular Formula | C16H12BrCl2NO |
| Molecular Weight | 385.09 g/mol |
| Exact Mass | 382.95 |
| IUPAC Name | (E)-N-(4-bromo-2-methylphenyl)-3-(2,4-dichlorophenyl)prop-2-enamide |
| SMILES | Cc1cc(Br)ccc1NC(=O)/C=C/c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C16H12BrCl2NO/c1-10-8-12(17)4-6-15(10)20-16(21)7-3-11-2-5-13(18)9-14(11)19/h2-9H,1H3,(H,20,21)/b7-3+ |
| InChIKey | YSTOTYYRIQALHB-XVNBXDOJSA-N |
| XLogP | 5.72 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.09 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|