C19H18BrCl2NO — CID 53267823
(E)-N-(2-bromo-4-butylphenyl)-3-(2,4-dichlorophenyl)prop-2-enamide (PubChem CID 53267823) has the molecular formula C19H18BrCl2NO and a molecular weight of 427.17 g/mol. Its IUPAC name is (E)-N-(2-bromo-4-butylphenyl)-3-(2,4-dichlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-(2-bromo-4-butylphenyl)-3-(2,4-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 53267823 |
| Molecular Formula | C19H18BrCl2NO |
| Molecular Weight | 427.17 g/mol |
| Exact Mass | 424.99 |
| IUPAC Name | (E)-N-(2-bromo-4-butylphenyl)-3-(2,4-dichlorophenyl)prop-2-enamide |
| SMILES | CCCCc1ccc(NC(=O)/C=C/c2ccc(Cl)cc2Cl)c(Br)c1 |
| InChI | InChI=1S/C19H18BrCl2NO/c1-2-3-4-13-5-9-18(16(20)11-13)23-19(24)10-7-14-6-8-15(21)12-17(14)22/h5-12H,2-4H2,1H3,(H,23,24)/b10-7+ |
| InChIKey | XSEHUYIHQQFNRJ-JXMROGBWSA-N |
| XLogP | 6.75 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.17 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|