C31H22Cl4N2O2 — CID 6184980
(E)-3-(2,4-dichlorophenyl)-N-[4-[[4-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]phenyl]methyl]phenyl]prop-2-enamide (PubChem CID 6184980) has the molecular formula C31H22Cl4N2O2 and a molecular weight of 596.34 g/mol. Its IUPAC name is (E)-3-(2,4-dichlorophenyl)-N-[4-[[4-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]phenyl]methyl]phenyl]prop-2-enamide.
| Compound Name | (E)-3-(2,4-dichlorophenyl)-N-[4-[[4-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]phenyl]methyl]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 6184980 |
| Molecular Formula | C31H22Cl4N2O2 |
| Molecular Weight | 596.34 g/mol |
| Exact Mass | 594.04 |
| IUPAC Name | (E)-3-(2,4-dichlorophenyl)-N-[4-[[4-[[(E)-3-(2,4-dichlorophenyl)prop-2-enoyl]amino]phenyl]methyl]phenyl]prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1Cl)Nc1ccc(Cc2ccc(NC(=O)/C=C/c3ccc(Cl)cc3Cl)cc2)cc1 |
| InChI | InChI=1S/C31H22Cl4N2O2/c32-24-9-5-22(28(34)18-24)7-15-30(38)36-26-11-1-20(2-12-26)17-21-3-13-27(14-4-21)37-31(39)16-8-23-6-10-25(33)19-29(23)35/h1-16,18-19H,17H2,(H,36,38)(H,37,39)/b15-7+,16-8+ |
| InChIKey | LCTYTRSEZDDQIW-BGPOSVGRSA-N |
| XLogP | 9.19 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.34 |
| LogP ≤ 5 | 9.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|