C19H18Cl2N2O3S — CID 17070631
(E)-3-(2,4-dichlorophenyl)-N-(4-pyrrolidin-1-ylsulfonylphenyl)prop-2-enamide (PubChem CID 17070631) has the molecular formula C19H18Cl2N2O3S and a molecular weight of 425.34 g/mol. Its IUPAC name is (E)-3-(2,4-dichlorophenyl)-N-(4-pyrrolidin-1-ylsulfonylphenyl)prop-2-enamide.
| Compound Name | (E)-3-(2,4-dichlorophenyl)-N-(4-pyrrolidin-1-ylsulfonylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 17070631 |
| Molecular Formula | C19H18Cl2N2O3S |
| Molecular Weight | 425.34 g/mol |
| Exact Mass | 424.04 |
| IUPAC Name | (E)-3-(2,4-dichlorophenyl)-N-(4-pyrrolidin-1-ylsulfonylphenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccc(Cl)cc1Cl)Nc1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C19H18Cl2N2O3S/c20-15-5-3-14(18(21)13-15)4-10-19(24)22-16-6-8-17(9-7-16)27(25,26)23-11-1-2-12-23/h3-10,13H,1-2,11-12H2,(H,22,24)/b10-4+ |
| InChIKey | YQZDSXLBNWDIQW-ONNFQVAWSA-N |
| XLogP | 4.43 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.34 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|