C21H23ClN2O3S — CID 17311807
(E)-3-(2-chlorophenyl)-N-[4-(3-methylpiperidin-1-yl)sulfonylphenyl]prop-2-enamide (PubChem CID 17311807) has the molecular formula C21H23ClN2O3S and a molecular weight of 418.95 g/mol. Its IUPAC name is (E)-3-(2-chlorophenyl)-N-[4-(3-methylpiperidin-1-yl)sulfonylphenyl]prop-2-enamide.
| Compound Name | (E)-3-(2-chlorophenyl)-N-[4-(3-methylpiperidin-1-yl)sulfonylphenyl]prop-2-enamide |
|---|---|
| PubChem CID | 17311807 |
| Molecular Formula | C21H23ClN2O3S |
| Molecular Weight | 418.95 g/mol |
| Exact Mass | 418.11 |
| IUPAC Name | (E)-3-(2-chlorophenyl)-N-[4-(3-methylpiperidin-1-yl)sulfonylphenyl]prop-2-enamide |
| SMILES | CC1CCCN(S(=O)(=O)c2ccc(NC(=O)/C=C/c3ccccc3Cl)cc2)C1 |
| InChI | InChI=1S/C21H23ClN2O3S/c1-16-5-4-14-24(15-16)28(26,27)19-11-9-18(10-12-19)23-21(25)13-8-17-6-2-3-7-20(17)22/h2-3,6-13,16H,4-5,14-15H2,1H3,(H,23,25)/b13-8+ |
| InChIKey | WYZBDCXUTPFQTG-MDWZMJQESA-N |
| XLogP | 4.41 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.95 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|