C32H30ClN3O3S — CID 6235037
(E)-N-[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]-3-(2-chlorophenyl)prop-2-enamide (PubChem CID 6235037) has the molecular formula C32H30ClN3O3S and a molecular weight of 572.13 g/mol. Its IUPAC name is (E)-N-[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]-3-(2-chlorophenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]-3-(2-chlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 6235037 |
| Molecular Formula | C32H30ClN3O3S |
| Molecular Weight | 572.13 g/mol |
| Exact Mass | 571.17 |
| IUPAC Name | (E)-N-[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]-3-(2-chlorophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1ccccc1Cl)Nc1ccc(S(=O)(=O)N2CCN(C(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C32H30ClN3O3S/c33-30-14-8-7-9-25(30)15-20-31(37)34-28-16-18-29(19-17-28)40(38,39)36-23-21-35(22-24-36)32(26-10-3-1-4-11-26)27-12-5-2-6-13-27/h1-20,32H,21-24H2,(H,34,37)/b20-15+ |
| InChIKey | JPSJSQXKOLYOGO-HMMYKYKNSA-N |
| XLogP | 6.09 |
| TPSA | 69.72 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.13 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|