C32H30N4O5S — CID 17176017
(E)-N-[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]-3-(3-nitrophenyl)prop-2-enamide (PubChem CID 17176017) has the molecular formula C32H30N4O5S and a molecular weight of 582.68 g/mol. Its IUPAC name is (E)-N-[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]-3-(3-nitrophenyl)prop-2-enamide.
| Compound Name | (E)-N-[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]-3-(3-nitrophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 17176017 |
| Molecular Formula | C32H30N4O5S |
| Molecular Weight | 582.68 g/mol |
| Exact Mass | 582.19 |
| IUPAC Name | (E)-N-[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]-3-(3-nitrophenyl)prop-2-enamide |
| SMILES | O=C(/C=C/c1cccc([N+](=O)[O-])c1)Nc1ccc(S(=O)(=O)N2CCN(C(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C32H30N4O5S/c37-31(19-14-25-8-7-13-29(24-25)36(38)39)33-28-15-17-30(18-16-28)42(40,41)35-22-20-34(21-23-35)32(26-9-3-1-4-10-26)27-11-5-2-6-12-27/h1-19,24,32H,20-23H2,(H,33,37)/b19-14+ |
| InChIKey | KTBVEBDUOLWWEO-XMHGGMMESA-N |
| XLogP | 5.34 |
| TPSA | 112.86 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.68 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|