C32H32N4O6S — CID 4951331
N-[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]-2-(4-nitrophenoxy)propanamide (PubChem CID 4951331) has the molecular formula C32H32N4O6S and a molecular weight of 600.70 g/mol. Its IUPAC name is N-[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]-2-(4-nitrophenoxy)propanamide.
| Compound Name | N-[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]-2-(4-nitrophenoxy)propanamide |
|---|---|
| PubChem CID | 4951331 |
| Molecular Formula | C32H32N4O6S |
| Molecular Weight | 600.70 g/mol |
| Exact Mass | 600.20 |
| IUPAC Name | N-[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]-2-(4-nitrophenoxy)propanamide |
| SMILES | CC(Oc1ccc([N+](=O)[O-])cc1)C(=O)Nc1ccc(S(=O)(=O)N2CCN(C(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C32H32N4O6S/c1-24(42-29-16-14-28(15-17-29)36(38)39)32(37)33-27-12-18-30(19-13-27)43(40,41)35-22-20-34(21-23-35)31(25-8-4-2-5-9-25)26-10-6-3-7-11-26/h2-19,24,31H,20-23H2,1H3,(H,33,37) |
| InChIKey | YYJDEBLTLGXXJU-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 122.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.70 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|