C32H31Cl2N3O4S — CID 4946409
N-[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]-2-(2,4-dichlorophenoxy)propanamide (PubChem CID 4946409) has the molecular formula C32H31Cl2N3O4S and a molecular weight of 624.59 g/mol. Its IUPAC name is N-[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]-2-(2,4-dichlorophenoxy)propanamide.
| Compound Name | N-[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]-2-(2,4-dichlorophenoxy)propanamide |
|---|---|
| PubChem CID | 4946409 |
| Molecular Formula | C32H31Cl2N3O4S |
| Molecular Weight | 624.59 g/mol |
| Exact Mass | 623.14 |
| IUPAC Name | N-[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]-2-(2,4-dichlorophenoxy)propanamide |
| SMILES | CC(Oc1ccc(Cl)cc1Cl)C(=O)Nc1ccc(S(=O)(=O)N2CCN(C(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C32H31Cl2N3O4S/c1-23(41-30-17-12-26(33)22-29(30)34)32(38)35-27-13-15-28(16-14-27)42(39,40)37-20-18-36(19-21-37)31(24-8-4-2-5-9-24)25-10-6-3-7-11-25/h2-17,22-23,31H,18-21H2,1H3,(H,35,38) |
| InChIKey | JZPOKRNICVVMRV-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 624.59 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |