C18H19Cl2NO2 — CID 1335441
(2R)-2-(2,4-dichlorophenoxy)-N-(4-propan-2-ylphenyl)propanamide (PubChem CID 1335441) has the molecular formula C18H19Cl2NO2 and a molecular weight of 352.26 g/mol. Its IUPAC name is (2R)-2-(2,4-dichlorophenoxy)-N-(4-propan-2-ylphenyl)propanamide.
| Compound Name | (2R)-2-(2,4-dichlorophenoxy)-N-(4-propan-2-ylphenyl)propanamide |
|---|---|
| PubChem CID | 1335441 |
| Molecular Formula | C18H19Cl2NO2 |
| Molecular Weight | 352.26 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | (2R)-2-(2,4-dichlorophenoxy)-N-(4-propan-2-ylphenyl)propanamide |
| SMILES | CC(C)c1ccc(NC(=O)[C@@H](C)Oc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C18H19Cl2NO2/c1-11(2)13-4-7-15(8-5-13)21-18(22)12(3)23-17-9-6-14(19)10-16(17)20/h4-12H,1-3H3,(H,21,22)/t12-/m1/s1 |
| InChIKey | XDUFQZONFKHCMN-GFCCVEGCSA-N |
| XLogP | 5.52 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.26 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |