C16H15Cl2N3O2S — CID 40652778
(2R)-N-[4-(carbamothioylamino)phenyl]-2-(2,4-dichlorophenoxy)propanamide (PubChem CID 40652778) has the molecular formula C16H15Cl2N3O2S and a molecular weight of 384.29 g/mol. Its IUPAC name is (2R)-N-[4-(carbamothioylamino)phenyl]-2-(2,4-dichlorophenoxy)propanamide.
| Compound Name | (2R)-N-[4-(carbamothioylamino)phenyl]-2-(2,4-dichlorophenoxy)propanamide |
|---|---|
| PubChem CID | 40652778 |
| Molecular Formula | C16H15Cl2N3O2S |
| Molecular Weight | 384.29 g/mol |
| Exact Mass | 383.03 |
| IUPAC Name | (2R)-N-[4-(carbamothioylamino)phenyl]-2-(2,4-dichlorophenoxy)propanamide |
| SMILES | C[C@@H](Oc1ccc(Cl)cc1Cl)C(=O)Nc1ccc(NC(N)=S)cc1 |
| InChI | InChI=1S/C16H15Cl2N3O2S/c1-9(23-14-7-2-10(17)8-13(14)18)15(22)20-11-3-5-12(6-4-11)21-16(19)24/h2-9H,1H3,(H,20,22)(H3,19,21,24)/t9-/m1/s1 |
| InChIKey | DNFCHNPCKCWREO-SECBINFHSA-N |
| XLogP | 4.05 |
| TPSA | 76.38 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.29 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|