C16H16Cl2N2O2 — CID 28867631
(2S)-N-(3-amino-4-methylphenyl)-2-(2,4-dichlorophenoxy)propanamide (PubChem CID 28867631) has the molecular formula C16H16Cl2N2O2 and a molecular weight of 339.22 g/mol. Its IUPAC name is (2S)-N-(3-amino-4-methylphenyl)-2-(2,4-dichlorophenoxy)propanamide.
| Compound Name | (2S)-N-(3-amino-4-methylphenyl)-2-(2,4-dichlorophenoxy)propanamide |
|---|---|
| PubChem CID | 28867631 |
| Molecular Formula | C16H16Cl2N2O2 |
| Molecular Weight | 339.22 g/mol |
| Exact Mass | 338.06 |
| IUPAC Name | (2S)-N-(3-amino-4-methylphenyl)-2-(2,4-dichlorophenoxy)propanamide |
| SMILES | Cc1ccc(NC(=O)[C@H](C)Oc2ccc(Cl)cc2Cl)cc1N |
| InChI | InChI=1S/C16H16Cl2N2O2/c1-9-3-5-12(8-14(9)19)20-16(21)10(2)22-15-6-4-11(17)7-13(15)18/h3-8,10H,19H2,1-2H3,(H,20,21)/t10-/m0/s1 |
| InChIKey | LHKGGLHCSJEDFF-JTQLQIEISA-N |
| XLogP | 4.29 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.22 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|