C17H15Cl2NO4 — CID 1010111
methyl 4-[[(2S)-2-(2,4-dichlorophenoxy)propanoyl]amino]benzoate (PubChem CID 1010111) has the molecular formula C17H15Cl2NO4 and a molecular weight of 368.22 g/mol. Its IUPAC name is methyl 4-[[(2S)-2-(2,4-dichlorophenoxy)propanoyl]amino]benzoate.
| Compound Name | methyl 4-[[(2S)-2-(2,4-dichlorophenoxy)propanoyl]amino]benzoate |
|---|---|
| PubChem CID | 1010111 |
| Molecular Formula | C17H15Cl2NO4 |
| Molecular Weight | 368.22 g/mol |
| Exact Mass | 367.04 |
| IUPAC Name | methyl 4-[[(2S)-2-(2,4-dichlorophenoxy)propanoyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)[C@H](C)Oc2ccc(Cl)cc2Cl)cc1 |
| InChI | InChI=1S/C17H15Cl2NO4/c1-10(24-15-8-5-12(18)9-14(15)19)16(21)20-13-6-3-11(4-7-13)17(22)23-2/h3-10H,1-2H3,(H,20,21)/t10-/m0/s1 |
| InChIKey | YKAPMZLTSWHGLA-JTQLQIEISA-N |
| XLogP | 4.19 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.22 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |