C18H17Cl2NO4 — CID 2122611
methyl 3-[[(2S)-2-(2,4-dichlorophenoxy)propanoyl]amino]-4-methylbenzoate (PubChem CID 2122611) has the molecular formula C18H17Cl2NO4 and a molecular weight of 382.24 g/mol. Its IUPAC name is methyl 3-[[(2S)-2-(2,4-dichlorophenoxy)propanoyl]amino]-4-methylbenzoate.
| Compound Name | methyl 3-[[(2S)-2-(2,4-dichlorophenoxy)propanoyl]amino]-4-methylbenzoate |
|---|---|
| PubChem CID | 2122611 |
| Molecular Formula | C18H17Cl2NO4 |
| Molecular Weight | 382.24 g/mol |
| Exact Mass | 381.05 |
| IUPAC Name | methyl 3-[[(2S)-2-(2,4-dichlorophenoxy)propanoyl]amino]-4-methylbenzoate |
| SMILES | COC(=O)c1ccc(C)c(NC(=O)[C@H](C)Oc2ccc(Cl)cc2Cl)c1 |
| InChI | InChI=1S/C18H17Cl2NO4/c1-10-4-5-12(18(23)24-3)8-15(10)21-17(22)11(2)25-16-7-6-13(19)9-14(16)20/h4-9,11H,1-3H3,(H,21,22)/t11-/m0/s1 |
| InChIKey | NSIVWTFDYVEUKO-NSHDSACASA-N |
| XLogP | 4.49 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.24 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |