C32H32ClN3O4S — CID 4932144
N-[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]-2-(2-chlorophenoxy)propanamide (PubChem CID 4932144) has the molecular formula C32H32ClN3O4S and a molecular weight of 590.15 g/mol. Its IUPAC name is N-[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]-2-(2-chlorophenoxy)propanamide.
| Compound Name | N-[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]-2-(2-chlorophenoxy)propanamide |
|---|---|
| PubChem CID | 4932144 |
| Molecular Formula | C32H32ClN3O4S |
| Molecular Weight | 590.15 g/mol |
| Exact Mass | 589.18 |
| IUPAC Name | N-[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]-2-(2-chlorophenoxy)propanamide |
| SMILES | CC(Oc1ccccc1Cl)C(=O)Nc1ccc(S(=O)(=O)N2CCN(C(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C32H32ClN3O4S/c1-24(40-30-15-9-8-14-29(30)33)32(37)34-27-16-18-28(19-17-27)41(38,39)36-22-20-35(21-23-36)31(25-10-4-2-5-11-25)26-12-6-3-7-13-26/h2-19,24,31H,20-23H2,1H3,(H,34,37) |
| InChIKey | FUIBZVUJLCKBKW-UHFFFAOYSA-N |
| XLogP | 5.84 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.15 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |