C34H37N3O4S — CID 4950124
N-[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]-2-(4-methylphenoxy)butanamide (PubChem CID 4950124) has the molecular formula C34H37N3O4S and a molecular weight of 583.75 g/mol. Its IUPAC name is N-[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]-2-(4-methylphenoxy)butanamide.
| Compound Name | N-[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]-2-(4-methylphenoxy)butanamide |
|---|---|
| PubChem CID | 4950124 |
| Molecular Formula | C34H37N3O4S |
| Molecular Weight | 583.75 g/mol |
| Exact Mass | 583.25 |
| IUPAC Name | N-[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]-2-(4-methylphenoxy)butanamide |
| SMILES | CCC(Oc1ccc(C)cc1)C(=O)Nc1ccc(S(=O)(=O)N2CCN(C(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C34H37N3O4S/c1-3-32(41-30-18-14-26(2)15-19-30)34(38)35-29-16-20-31(21-17-29)42(39,40)37-24-22-36(23-25-37)33(27-10-6-4-7-11-27)28-12-8-5-9-13-28/h4-21,32-33H,3,22-25H2,1-2H3,(H,35,38) |
| InChIKey | LRLOVSHBDQIEJQ-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.75 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |