C33H35N3O5S — CID 17353555
N-[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]-4-(2-methoxyethoxy)benzamide (PubChem CID 17353555) has the molecular formula C33H35N3O5S and a molecular weight of 585.73 g/mol. Its IUPAC name is N-[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]-4-(2-methoxyethoxy)benzamide.
| Compound Name | N-[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]-4-(2-methoxyethoxy)benzamide |
|---|---|
| PubChem CID | 17353555 |
| Molecular Formula | C33H35N3O5S |
| Molecular Weight | 585.73 g/mol |
| Exact Mass | 585.23 |
| IUPAC Name | N-[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]-4-(2-methoxyethoxy)benzamide |
| SMILES | COCCOc1ccc(C(=O)Nc2ccc(S(=O)(=O)N3CCN(C(c4ccccc4)c4ccccc4)CC3)cc2)cc1 |
| InChI | InChI=1S/C33H35N3O5S/c1-40-24-25-41-30-16-12-28(13-17-30)33(37)34-29-14-18-31(19-15-29)42(38,39)36-22-20-35(21-23-36)32(26-8-4-2-5-9-26)27-10-6-3-7-11-27/h2-19,32H,20-25H2,1H3,(H,34,37) |
| InChIKey | ZOAJUMLEHYTHIL-UHFFFAOYSA-N |
| XLogP | 5.06 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.73 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|