C34H37N3O5S — CID 17122780
N-[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]-2-(2-ethoxyethoxy)benzamide (PubChem CID 17122780) has the molecular formula C34H37N3O5S and a molecular weight of 599.75 g/mol. Its IUPAC name is N-[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]-2-(2-ethoxyethoxy)benzamide.
| Compound Name | N-[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]-2-(2-ethoxyethoxy)benzamide |
|---|---|
| PubChem CID | 17122780 |
| Molecular Formula | C34H37N3O5S |
| Molecular Weight | 599.75 g/mol |
| Exact Mass | 599.25 |
| IUPAC Name | N-[4-(4-benzhydrylpiperazin-1-yl)sulfonylphenyl]-2-(2-ethoxyethoxy)benzamide |
| SMILES | CCOCCOc1ccccc1C(=O)Nc1ccc(S(=O)(=O)N2CCN(C(c3ccccc3)c3ccccc3)CC2)cc1 |
| InChI | InChI=1S/C34H37N3O5S/c1-2-41-25-26-42-32-16-10-9-15-31(32)34(38)35-29-17-19-30(20-18-29)43(39,40)37-23-21-36(22-24-37)33(27-11-5-3-6-12-27)28-13-7-4-8-14-28/h3-20,33H,2,21-26H2,1H3,(H,35,38) |
| InChIKey | WHMLTJJGAPZHPL-UHFFFAOYSA-N |
| XLogP | 5.45 |
| TPSA | 88.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 599.75 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|