C25H34N2O4S — CID 4942049
2-hexoxy-N-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]benzamide (PubChem CID 4942049) has the molecular formula C25H34N2O4S and a molecular weight of 458.62 g/mol. Its IUPAC name is 2-hexoxy-N-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]benzamide.
| Compound Name | 2-hexoxy-N-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]benzamide |
|---|---|
| PubChem CID | 4942049 |
| Molecular Formula | C25H34N2O4S |
| Molecular Weight | 458.62 g/mol |
| Exact Mass | 458.22 |
| IUPAC Name | 2-hexoxy-N-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]benzamide |
| SMILES | CCCCCCOc1ccccc1C(=O)Nc1ccc(S(=O)(=O)N2CCC(C)CC2)cc1 |
| InChI | InChI=1S/C25H34N2O4S/c1-3-4-5-8-19-31-24-10-7-6-9-23(24)25(28)26-21-11-13-22(14-12-21)32(29,30)27-17-15-20(2)16-18-27/h6-7,9-14,20H,3-5,8,15-19H2,1-2H3,(H,26,28) |
| InChIKey | JMTKBTJKVJOMRT-UHFFFAOYSA-N |
| XLogP | 5.32 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.62 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|