C23H29BrN2O4S — CID 17349990
5-bromo-2-butoxy-N-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]benzamide (PubChem CID 17349990) has the molecular formula C23H29BrN2O4S and a molecular weight of 509.47 g/mol. Its IUPAC name is 5-bromo-2-butoxy-N-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]benzamide.
| Compound Name | 5-bromo-2-butoxy-N-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]benzamide |
|---|---|
| PubChem CID | 17349990 |
| Molecular Formula | C23H29BrN2O4S |
| Molecular Weight | 509.47 g/mol |
| Exact Mass | 508.10 |
| IUPAC Name | 5-bromo-2-butoxy-N-[4-(4-methylpiperidin-1-yl)sulfonylphenyl]benzamide |
| SMILES | CCCCOc1ccc(Br)cc1C(=O)Nc1ccc(S(=O)(=O)N2CCC(C)CC2)cc1 |
| InChI | InChI=1S/C23H29BrN2O4S/c1-3-4-15-30-22-10-5-18(24)16-21(22)23(27)25-19-6-8-20(9-7-19)31(28,29)26-13-11-17(2)12-14-26/h5-10,16-17H,3-4,11-15H2,1-2H3,(H,25,27) |
| InChIKey | WVMPRZLKHCRLRI-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.47 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|