C21H25BrN2O4S — CID 17050773
5-bromo-2-(2-methylpropoxy)-N-(4-pyrrolidin-1-ylsulfonylphenyl)benzamide (PubChem CID 17050773) has the molecular formula C21H25BrN2O4S and a molecular weight of 481.41 g/mol. Its IUPAC name is 5-bromo-2-(2-methylpropoxy)-N-(4-pyrrolidin-1-ylsulfonylphenyl)benzamide.
| Compound Name | 5-bromo-2-(2-methylpropoxy)-N-(4-pyrrolidin-1-ylsulfonylphenyl)benzamide |
|---|---|
| PubChem CID | 17050773 |
| Molecular Formula | C21H25BrN2O4S |
| Molecular Weight | 481.41 g/mol |
| Exact Mass | 480.07 |
| IUPAC Name | 5-bromo-2-(2-methylpropoxy)-N-(4-pyrrolidin-1-ylsulfonylphenyl)benzamide |
| SMILES | CC(C)COc1ccc(Br)cc1C(=O)Nc1ccc(S(=O)(=O)N2CCCC2)cc1 |
| InChI | InChI=1S/C21H25BrN2O4S/c1-15(2)14-28-20-10-5-16(22)13-19(20)21(25)23-17-6-8-18(9-7-17)29(26,27)24-11-3-4-12-24/h5-10,13,15H,3-4,11-12,14H2,1-2H3,(H,23,25) |
| InChIKey | AYNAOTZBMSHCOJ-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.41 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |