C24H31BrN4O4S2 — CID 17351055
5-bromo-2-(3-methylbutoxy)-N-[[4-(4-methylpiperazin-1-yl)sulfonylphenyl]carbamothioyl]benzamide (PubChem CID 17351055) has the molecular formula C24H31BrN4O4S2 and a molecular weight of 583.57 g/mol. Its IUPAC name is 5-bromo-2-(3-methylbutoxy)-N-[[4-(4-methylpiperazin-1-yl)sulfonylphenyl]carbamothioyl]benzamide.
| Compound Name | 5-bromo-2-(3-methylbutoxy)-N-[[4-(4-methylpiperazin-1-yl)sulfonylphenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17351055 |
| Molecular Formula | C24H31BrN4O4S2 |
| Molecular Weight | 583.57 g/mol |
| Exact Mass | 582.10 |
| IUPAC Name | 5-bromo-2-(3-methylbutoxy)-N-[[4-(4-methylpiperazin-1-yl)sulfonylphenyl]carbamothioyl]benzamide |
| SMILES | CC(C)CCOc1ccc(Br)cc1C(=O)NC(=S)Nc1ccc(S(=O)(=O)N2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C24H31BrN4O4S2/c1-17(2)10-15-33-22-9-4-18(25)16-21(22)23(30)27-24(34)26-19-5-7-20(8-6-19)35(31,32)29-13-11-28(3)12-14-29/h4-9,16-17H,10-15H2,1-3H3,(H2,26,27,30,34) |
| InChIKey | FJHYNSBBXRVYDD-UHFFFAOYSA-N |
| XLogP | 3.94 |
| TPSA | 90.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 583.57 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|