C22H27BrN4O5S2 — CID 17357554
5-bromo-2-(2-methoxyethoxy)-N-[[4-(4-methylpiperazin-1-yl)sulfonylphenyl]carbamothioyl]benzamide (PubChem CID 17357554) has the molecular formula C22H27BrN4O5S2 and a molecular weight of 571.52 g/mol. Its IUPAC name is 5-bromo-2-(2-methoxyethoxy)-N-[[4-(4-methylpiperazin-1-yl)sulfonylphenyl]carbamothioyl]benzamide.
| Compound Name | 5-bromo-2-(2-methoxyethoxy)-N-[[4-(4-methylpiperazin-1-yl)sulfonylphenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17357554 |
| Molecular Formula | C22H27BrN4O5S2 |
| Molecular Weight | 571.52 g/mol |
| Exact Mass | 570.06 |
| IUPAC Name | 5-bromo-2-(2-methoxyethoxy)-N-[[4-(4-methylpiperazin-1-yl)sulfonylphenyl]carbamothioyl]benzamide |
| SMILES | COCCOc1ccc(Br)cc1C(=O)NC(=S)Nc1ccc(S(=O)(=O)N2CCN(C)CC2)cc1 |
| InChI | InChI=1S/C22H27BrN4O5S2/c1-26-9-11-27(12-10-26)34(29,30)18-6-4-17(5-7-18)24-22(33)25-21(28)19-15-16(23)3-8-20(19)32-14-13-31-2/h3-8,15H,9-14H2,1-2H3,(H2,24,25,28,33) |
| InChIKey | AULGTBCBNZZHQN-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.52 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|