C18H18BrClN2O3S — CID 17357551
5-bromo-N-[(3-chloro-4-methylphenyl)carbamothioyl]-2-(2-methoxyethoxy)benzamide (PubChem CID 17357551) has the molecular formula C18H18BrClN2O3S and a molecular weight of 457.78 g/mol. Its IUPAC name is 5-bromo-N-[(3-chloro-4-methylphenyl)carbamothioyl]-2-(2-methoxyethoxy)benzamide.
| Compound Name | 5-bromo-N-[(3-chloro-4-methylphenyl)carbamothioyl]-2-(2-methoxyethoxy)benzamide |
|---|---|
| PubChem CID | 17357551 |
| Molecular Formula | C18H18BrClN2O3S |
| Molecular Weight | 457.78 g/mol |
| Exact Mass | 455.99 |
| IUPAC Name | 5-bromo-N-[(3-chloro-4-methylphenyl)carbamothioyl]-2-(2-methoxyethoxy)benzamide |
| SMILES | COCCOc1ccc(Br)cc1C(=O)NC(=S)Nc1ccc(C)c(Cl)c1 |
| InChI | InChI=1S/C18H18BrClN2O3S/c1-11-3-5-13(10-15(11)20)21-18(26)22-17(23)14-9-12(19)4-6-16(14)25-8-7-24-2/h3-6,9-10H,7-8H2,1-2H3,(H2,21,22,23,26) |
| InChIKey | XNRDYXDVGVRTNY-UHFFFAOYSA-N |
| XLogP | 4.56 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.78 |
| LogP ≤ 5 | 4.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|