C17H17BrN2O4S — CID 17357450
5-bromo-N-[(4-hydroxyphenyl)carbamothioyl]-2-(2-methoxyethoxy)benzamide (PubChem CID 17357450) has the molecular formula C17H17BrN2O4S and a molecular weight of 425.30 g/mol. Its IUPAC name is 5-bromo-N-[(4-hydroxyphenyl)carbamothioyl]-2-(2-methoxyethoxy)benzamide.
| Compound Name | 5-bromo-N-[(4-hydroxyphenyl)carbamothioyl]-2-(2-methoxyethoxy)benzamide |
|---|---|
| PubChem CID | 17357450 |
| Molecular Formula | C17H17BrN2O4S |
| Molecular Weight | 425.30 g/mol |
| Exact Mass | 424.01 |
| IUPAC Name | 5-bromo-N-[(4-hydroxyphenyl)carbamothioyl]-2-(2-methoxyethoxy)benzamide |
| SMILES | COCCOc1ccc(Br)cc1C(=O)NC(=S)Nc1ccc(O)cc1 |
| InChI | InChI=1S/C17H17BrN2O4S/c1-23-8-9-24-15-7-2-11(18)10-14(15)16(22)20-17(25)19-12-3-5-13(21)6-4-12/h2-7,10,21H,8-9H2,1H3,(H2,19,20,22,25) |
| InChIKey | ITWXUFXJNQEFKL-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 79.82 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.30 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|