C19H20BrClN2O3S — CID 17350512
5-bromo-2-butoxy-N-[(3-chloro-4-methoxyphenyl)carbamothioyl]benzamide (PubChem CID 17350512) has the molecular formula C19H20BrClN2O3S and a molecular weight of 471.80 g/mol. Its IUPAC name is 5-bromo-2-butoxy-N-[(3-chloro-4-methoxyphenyl)carbamothioyl]benzamide.
| Compound Name | 5-bromo-2-butoxy-N-[(3-chloro-4-methoxyphenyl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17350512 |
| Molecular Formula | C19H20BrClN2O3S |
| Molecular Weight | 471.80 g/mol |
| Exact Mass | 470.01 |
| IUPAC Name | 5-bromo-2-butoxy-N-[(3-chloro-4-methoxyphenyl)carbamothioyl]benzamide |
| SMILES | CCCCOc1ccc(Br)cc1C(=O)NC(=S)Nc1ccc(OC)c(Cl)c1 |
| InChI | InChI=1S/C19H20BrClN2O3S/c1-3-4-9-26-16-7-5-12(20)10-14(16)18(24)23-19(27)22-13-6-8-17(25-2)15(21)11-13/h5-8,10-11H,3-4,9H2,1-2H3,(H2,22,23,24,27) |
| InChIKey | LHMGAJCPOLFZPL-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.80 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|