C22H28BrN3O2S — CID 17350358
5-bromo-2-butoxy-N-[[4-(diethylamino)phenyl]carbamothioyl]benzamide (PubChem CID 17350358) has the molecular formula C22H28BrN3O2S and a molecular weight of 478.46 g/mol. Its IUPAC name is 5-bromo-2-butoxy-N-[[4-(diethylamino)phenyl]carbamothioyl]benzamide.
| Compound Name | 5-bromo-2-butoxy-N-[[4-(diethylamino)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17350358 |
| Molecular Formula | C22H28BrN3O2S |
| Molecular Weight | 478.46 g/mol |
| Exact Mass | 477.11 |
| IUPAC Name | 5-bromo-2-butoxy-N-[[4-(diethylamino)phenyl]carbamothioyl]benzamide |
| SMILES | CCCCOc1ccc(Br)cc1C(=O)NC(=S)Nc1ccc(N(CC)CC)cc1 |
| InChI | InChI=1S/C22H28BrN3O2S/c1-4-7-14-28-20-13-8-16(23)15-19(20)21(27)25-22(29)24-17-9-11-18(12-10-17)26(5-2)6-3/h8-13,15H,4-7,14H2,1-3H3,(H2,24,25,27,29) |
| InChIKey | DYNRCLXXGJGZIK-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 53.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.46 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|