C24H31BrN2O4S — CID 17130781
5-bromo-N-[[4-(2-ethoxyethoxy)phenyl]carbamothioyl]-2-hexoxybenzamide (PubChem CID 17130781) has the molecular formula C24H31BrN2O4S and a molecular weight of 523.49 g/mol. Its IUPAC name is 5-bromo-N-[[4-(2-ethoxyethoxy)phenyl]carbamothioyl]-2-hexoxybenzamide.
| Compound Name | 5-bromo-N-[[4-(2-ethoxyethoxy)phenyl]carbamothioyl]-2-hexoxybenzamide |
|---|---|
| PubChem CID | 17130781 |
| Molecular Formula | C24H31BrN2O4S |
| Molecular Weight | 523.49 g/mol |
| Exact Mass | 522.12 |
| IUPAC Name | 5-bromo-N-[[4-(2-ethoxyethoxy)phenyl]carbamothioyl]-2-hexoxybenzamide |
| SMILES | CCCCCCOc1ccc(Br)cc1C(=O)NC(=S)Nc1ccc(OCCOCC)cc1 |
| InChI | InChI=1S/C24H31BrN2O4S/c1-3-5-6-7-14-31-22-13-8-18(25)17-21(22)23(28)27-24(32)26-19-9-11-20(12-10-19)30-16-15-29-4-2/h8-13,17H,3-7,14-16H2,1-2H3,(H2,26,27,28,32) |
| InChIKey | LBSPKBWYMXXNJI-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.49 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|