C23H30BrNO3 — CID 17350069
5-bromo-2-butoxy-N-(4-hexoxyphenyl)benzamide (PubChem CID 17350069) has the molecular formula C23H30BrNO3 and a molecular weight of 448.40 g/mol. Its IUPAC name is 5-bromo-2-butoxy-N-(4-hexoxyphenyl)benzamide.
| Compound Name | 5-bromo-2-butoxy-N-(4-hexoxyphenyl)benzamide |
|---|---|
| PubChem CID | 17350069 |
| Molecular Formula | C23H30BrNO3 |
| Molecular Weight | 448.40 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | 5-bromo-2-butoxy-N-(4-hexoxyphenyl)benzamide |
| SMILES | CCCCCCOc1ccc(NC(=O)c2cc(Br)ccc2OCCCC)cc1 |
| InChI | InChI=1S/C23H30BrNO3/c1-3-5-7-8-16-27-20-12-10-19(11-13-20)25-23(26)21-17-18(24)9-14-22(21)28-15-6-4-2/h9-14,17H,3-8,15-16H2,1-2H3,(H,25,26) |
| InChIKey | VHNGIDZQLBXJQW-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.40 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|