C26H35BrN2O3S — CID 17351139
5-bromo-N-[(4-heptoxyphenyl)carbamothioyl]-2-(3-methylbutoxy)benzamide (PubChem CID 17351139) has the molecular formula C26H35BrN2O3S and a molecular weight of 535.55 g/mol. Its IUPAC name is 5-bromo-N-[(4-heptoxyphenyl)carbamothioyl]-2-(3-methylbutoxy)benzamide.
| Compound Name | 5-bromo-N-[(4-heptoxyphenyl)carbamothioyl]-2-(3-methylbutoxy)benzamide |
|---|---|
| PubChem CID | 17351139 |
| Molecular Formula | C26H35BrN2O3S |
| Molecular Weight | 535.55 g/mol |
| Exact Mass | 534.16 |
| IUPAC Name | 5-bromo-N-[(4-heptoxyphenyl)carbamothioyl]-2-(3-methylbutoxy)benzamide |
| SMILES | CCCCCCCOc1ccc(NC(=S)NC(=O)c2cc(Br)ccc2OCCC(C)C)cc1 |
| InChI | InChI=1S/C26H35BrN2O3S/c1-4-5-6-7-8-16-31-22-12-10-21(11-13-22)28-26(33)29-25(30)23-18-20(27)9-14-24(23)32-17-15-19(2)3/h9-14,18-19H,4-8,15-17H2,1-3H3,(H2,28,29,30,33) |
| InChIKey | XHLFXFPYVHYLRZ-UHFFFAOYSA-N |
| XLogP | 7.35 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.55 |
| LogP ≤ 5 | 7.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|