C21H22BrN3O2S — CID 17343605
5-bromo-N-[(4-cyanophenyl)carbamothioyl]-2-hexoxybenzamide (PubChem CID 17343605) has the molecular formula C21H22BrN3O2S and a molecular weight of 460.40 g/mol. Its IUPAC name is 5-bromo-N-[(4-cyanophenyl)carbamothioyl]-2-hexoxybenzamide.
| Compound Name | 5-bromo-N-[(4-cyanophenyl)carbamothioyl]-2-hexoxybenzamide |
|---|---|
| PubChem CID | 17343605 |
| Molecular Formula | C21H22BrN3O2S |
| Molecular Weight | 460.40 g/mol |
| Exact Mass | 459.06 |
| IUPAC Name | 5-bromo-N-[(4-cyanophenyl)carbamothioyl]-2-hexoxybenzamide |
| SMILES | CCCCCCOc1ccc(Br)cc1C(=O)NC(=S)Nc1ccc(C#N)cc1 |
| InChI | InChI=1S/C21H22BrN3O2S/c1-2-3-4-5-12-27-19-11-8-16(22)13-18(19)20(26)25-21(28)24-17-9-6-15(14-23)7-10-17/h6-11,13H,2-5,12H2,1H3,(H2,24,25,26,28) |
| InChIKey | HXRVTTUWUSQSNZ-UHFFFAOYSA-N |
| XLogP | 5.41 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.40 |
| LogP ≤ 5 | 5.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|