C32H38Br2N2O4 — CID 17344071
5-bromo-N-[4-[(5-bromo-2-hexoxybenzoyl)amino]phenyl]-2-hexoxybenzamide (PubChem CID 17344071) has the molecular formula C32H38Br2N2O4 and a molecular weight of 674.47 g/mol. Its IUPAC name is 5-bromo-N-[4-[(5-bromo-2-hexoxybenzoyl)amino]phenyl]-2-hexoxybenzamide.
| Compound Name | 5-bromo-N-[4-[(5-bromo-2-hexoxybenzoyl)amino]phenyl]-2-hexoxybenzamide |
|---|---|
| PubChem CID | 17344071 |
| Molecular Formula | C32H38Br2N2O4 |
| Molecular Weight | 674.47 g/mol |
| Exact Mass | 672.12 |
| IUPAC Name | 5-bromo-N-[4-[(5-bromo-2-hexoxybenzoyl)amino]phenyl]-2-hexoxybenzamide |
| SMILES | CCCCCCOc1ccc(Br)cc1C(=O)Nc1ccc(NC(=O)c2cc(Br)ccc2OCCCCCC)cc1 |
| InChI | InChI=1S/C32H38Br2N2O4/c1-3-5-7-9-19-39-29-17-11-23(33)21-27(29)31(37)35-25-13-15-26(16-14-25)36-32(38)28-22-24(34)12-18-30(28)40-20-10-8-6-4-2/h11-18,21-22H,3-10,19-20H2,1-2H3,(H,35,37)(H,36,38) |
| InChIKey | YYHWDMDNJULHKC-UHFFFAOYSA-N |
| XLogP | 9.63 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 674.47 |
| LogP ≤ 5 | 9.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|