C22H29BrN2O4S — CID 17343411
5-bromo-2-hexoxy-N-[4-(propan-2-ylsulfamoyl)phenyl]benzamide (PubChem CID 17343411) has the molecular formula C22H29BrN2O4S and a molecular weight of 497.46 g/mol. Its IUPAC name is 5-bromo-2-hexoxy-N-[4-(propan-2-ylsulfamoyl)phenyl]benzamide.
| Compound Name | 5-bromo-2-hexoxy-N-[4-(propan-2-ylsulfamoyl)phenyl]benzamide |
|---|---|
| PubChem CID | 17343411 |
| Molecular Formula | C22H29BrN2O4S |
| Molecular Weight | 497.46 g/mol |
| Exact Mass | 496.10 |
| IUPAC Name | 5-bromo-2-hexoxy-N-[4-(propan-2-ylsulfamoyl)phenyl]benzamide |
| SMILES | CCCCCCOc1ccc(Br)cc1C(=O)Nc1ccc(S(=O)(=O)NC(C)C)cc1 |
| InChI | InChI=1S/C22H29BrN2O4S/c1-4-5-6-7-14-29-21-13-8-17(23)15-20(21)22(26)24-18-9-11-19(12-10-18)30(27,28)25-16(2)3/h8-13,15-16,25H,4-7,14H2,1-3H3,(H,24,26) |
| InChIKey | PATUFUWSKKMWSA-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.46 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|