C24H27BrN2O5S — CID 17170978
5-bromo-N-[4-(furan-2-ylmethylsulfamoyl)phenyl]-2-hexoxybenzamide (PubChem CID 17170978) has the molecular formula C24H27BrN2O5S and a molecular weight of 535.46 g/mol. Its IUPAC name is 5-bromo-N-[4-(furan-2-ylmethylsulfamoyl)phenyl]-2-hexoxybenzamide.
| Compound Name | 5-bromo-N-[4-(furan-2-ylmethylsulfamoyl)phenyl]-2-hexoxybenzamide |
|---|---|
| PubChem CID | 17170978 |
| Molecular Formula | C24H27BrN2O5S |
| Molecular Weight | 535.46 g/mol |
| Exact Mass | 534.08 |
| IUPAC Name | 5-bromo-N-[4-(furan-2-ylmethylsulfamoyl)phenyl]-2-hexoxybenzamide |
| SMILES | CCCCCCOc1ccc(Br)cc1C(=O)Nc1ccc(S(=O)(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C24H27BrN2O5S/c1-2-3-4-5-14-32-23-13-8-18(25)16-22(23)24(28)27-19-9-11-21(12-10-19)33(29,30)26-17-20-7-6-15-31-20/h6-13,15-16,26H,2-5,14,17H2,1H3,(H,27,28) |
| InChIKey | VFAUHMRGCCRPOS-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.46 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|