C16H20BrNO4S — CID 16645093
4-bromo-N-(furan-2-ylmethyl)-3-pentoxybenzenesulfonamide (PubChem CID 16645093) has the molecular formula C16H20BrNO4S and a molecular weight of 402.31 g/mol. Its IUPAC name is 4-bromo-N-(furan-2-ylmethyl)-3-pentoxybenzenesulfonamide.
| Compound Name | 4-bromo-N-(furan-2-ylmethyl)-3-pentoxybenzenesulfonamide |
|---|---|
| PubChem CID | 16645093 |
| Molecular Formula | C16H20BrNO4S |
| Molecular Weight | 402.31 g/mol |
| Exact Mass | 401.03 |
| IUPAC Name | 4-bromo-N-(furan-2-ylmethyl)-3-pentoxybenzenesulfonamide |
| SMILES | CCCCCOc1cc(S(=O)(=O)NCc2ccco2)ccc1Br |
| InChI | InChI=1S/C16H20BrNO4S/c1-2-3-4-9-22-16-11-14(7-8-15(16)17)23(19,20)18-12-13-6-5-10-21-13/h5-8,10-11,18H,2-4,9,12H2,1H3 |
| InChIKey | FQDPBJFPSMPALG-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.31 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|