C13H14FNO4S — CID 934514
3-ethoxy-4-fluoro-N-(furan-2-ylmethyl)benzenesulfonamide (PubChem CID 934514) has the molecular formula C13H14FNO4S and a molecular weight of 299.32 g/mol. Its IUPAC name is 3-ethoxy-4-fluoro-N-(furan-2-ylmethyl)benzenesulfonamide.
| Compound Name | 3-ethoxy-4-fluoro-N-(furan-2-ylmethyl)benzenesulfonamide |
|---|---|
| PubChem CID | 934514 |
| Molecular Formula | C13H14FNO4S |
| Molecular Weight | 299.32 g/mol |
| Exact Mass | 299.06 |
| IUPAC Name | 3-ethoxy-4-fluoro-N-(furan-2-ylmethyl)benzenesulfonamide |
| SMILES | CCOc1cc(S(=O)(=O)NCc2ccco2)ccc1F |
| InChI | InChI=1S/C13H14FNO4S/c1-2-18-13-8-11(5-6-12(13)14)20(16,17)15-9-10-4-3-7-19-10/h3-8,15H,2,9H2,1H3 |
| InChIKey | HAESOYIMTAFDNY-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 299.32 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |