C24H28N2O6S — CID 55347369
N-[1-(3,4-diethoxyphenyl)ethyl]-4-(furan-2-ylmethylsulfamoyl)benzamide (PubChem CID 55347369) has the molecular formula C24H28N2O6S and a molecular weight of 472.56 g/mol. Its IUPAC name is N-[1-(3,4-diethoxyphenyl)ethyl]-4-(furan-2-ylmethylsulfamoyl)benzamide.
| Compound Name | N-[1-(3,4-diethoxyphenyl)ethyl]-4-(furan-2-ylmethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 55347369 |
| Molecular Formula | C24H28N2O6S |
| Molecular Weight | 472.56 g/mol |
| Exact Mass | 472.17 |
| IUPAC Name | N-[1-(3,4-diethoxyphenyl)ethyl]-4-(furan-2-ylmethylsulfamoyl)benzamide |
| SMILES | CCOc1ccc(C(C)NC(=O)c2ccc(S(=O)(=O)NCc3ccco3)cc2)cc1OCC |
| InChI | InChI=1S/C24H28N2O6S/c1-4-30-22-13-10-19(15-23(22)31-5-2)17(3)26-24(27)18-8-11-21(12-9-18)33(28,29)25-16-20-7-6-14-32-20/h6-15,17,25H,4-5,16H2,1-3H3,(H,26,27) |
| InChIKey | SBECFPOMGDUKOG-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 106.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 472.56 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |