C23H24N2O6S — CID 55439968
methyl 3-[[4-(furan-2-ylmethylsulfamoyl)benzoyl]amino]-3-(4-methylphenyl)propanoate (PubChem CID 55439968) has the molecular formula C23H24N2O6S and a molecular weight of 456.52 g/mol. Its IUPAC name is methyl 3-[[4-(furan-2-ylmethylsulfamoyl)benzoyl]amino]-3-(4-methylphenyl)propanoate.
| Compound Name | methyl 3-[[4-(furan-2-ylmethylsulfamoyl)benzoyl]amino]-3-(4-methylphenyl)propanoate |
|---|---|
| PubChem CID | 55439968 |
| Molecular Formula | C23H24N2O6S |
| Molecular Weight | 456.52 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | methyl 3-[[4-(furan-2-ylmethylsulfamoyl)benzoyl]amino]-3-(4-methylphenyl)propanoate |
| SMILES | COC(=O)CC(NC(=O)c1ccc(S(=O)(=O)NCc2ccco2)cc1)c1ccc(C)cc1 |
| InChI | InChI=1S/C23H24N2O6S/c1-16-5-7-17(8-6-16)21(14-22(26)30-2)25-23(27)18-9-11-20(12-10-18)32(28,29)24-15-19-4-3-13-31-19/h3-13,21,24H,14-15H2,1-2H3,(H,25,27) |
| InChIKey | KHISOUAQRABGJK-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 114.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.52 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |