C23H26N2O7S — CID 55709322
4-(furan-2-ylmethylsulfamoyl)-N-[1-(3,4,5-trimethoxyphenyl)ethyl]benzamide (PubChem CID 55709322) has the molecular formula C23H26N2O7S and a molecular weight of 474.54 g/mol. Its IUPAC name is 4-(furan-2-ylmethylsulfamoyl)-N-[1-(3,4,5-trimethoxyphenyl)ethyl]benzamide.
| Compound Name | 4-(furan-2-ylmethylsulfamoyl)-N-[1-(3,4,5-trimethoxyphenyl)ethyl]benzamide |
|---|---|
| PubChem CID | 55709322 |
| Molecular Formula | C23H26N2O7S |
| Molecular Weight | 474.54 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | 4-(furan-2-ylmethylsulfamoyl)-N-[1-(3,4,5-trimethoxyphenyl)ethyl]benzamide |
| SMILES | COc1cc(C(C)NC(=O)c2ccc(S(=O)(=O)NCc3ccco3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C23H26N2O7S/c1-15(17-12-20(29-2)22(31-4)21(13-17)30-3)25-23(26)16-7-9-19(10-8-16)33(27,28)24-14-18-6-5-11-32-18/h5-13,15,24H,14H2,1-4H3,(H,25,26) |
| InChIKey | SUPJYTNACDULJQ-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 116.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.54 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |