C22H24N2O4S — CID 24548503
4-(furan-2-ylmethylsulfamoyl)-N-(2-phenylbutyl)benzamide (PubChem CID 24548503) has the molecular formula C22H24N2O4S and a molecular weight of 412.51 g/mol. Its IUPAC name is 4-(furan-2-ylmethylsulfamoyl)-N-(2-phenylbutyl)benzamide.
| Compound Name | 4-(furan-2-ylmethylsulfamoyl)-N-(2-phenylbutyl)benzamide |
|---|---|
| PubChem CID | 24548503 |
| Molecular Formula | C22H24N2O4S |
| Molecular Weight | 412.51 g/mol |
| Exact Mass | 412.15 |
| IUPAC Name | 4-(furan-2-ylmethylsulfamoyl)-N-(2-phenylbutyl)benzamide |
| SMILES | CCC(CNC(=O)c1ccc(S(=O)(=O)NCc2ccco2)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H24N2O4S/c1-2-17(18-7-4-3-5-8-18)15-23-22(25)19-10-12-21(13-11-19)29(26,27)24-16-20-9-6-14-28-20/h3-14,17,24H,2,15-16H2,1H3,(H,23,25) |
| InChIKey | OZUSRJJYYIPXKL-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 88.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.51 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |