C22H26N3O4S+ — CID 2112676
[(1R)-2-[[4-(furan-2-ylmethylsulfamoyl)benzoyl]amino]-1-phenylethyl]-dimethylazanium (PubChem CID 2112676) has the molecular formula C22H26N3O4S+ and a molecular weight of 428.53 g/mol. Its IUPAC name is [(1R)-2-[[4-(furan-2-ylmethylsulfamoyl)benzoyl]amino]-1-phenylethyl]-dimethylazanium.
| Compound Name | [(1R)-2-[[4-(furan-2-ylmethylsulfamoyl)benzoyl]amino]-1-phenylethyl]-dimethylazanium |
|---|---|
| PubChem CID | 2112676 |
| Molecular Formula | C22H26N3O4S+ |
| Molecular Weight | 428.53 g/mol |
| Exact Mass | 428.16 |
| IUPAC Name | [(1R)-2-[[4-(furan-2-ylmethylsulfamoyl)benzoyl]amino]-1-phenylethyl]-dimethylazanium |
| SMILES | C[NH+](C)[C@@H](CNC(=O)c1ccc(S(=O)(=O)NCc2ccco2)cc1)c1ccccc1 |
| InChI | InChI=1S/C22H25N3O4S/c1-25(2)21(17-7-4-3-5-8-17)16-23-22(26)18-10-12-20(13-11-18)30(27,28)24-15-19-9-6-14-29-19/h3-14,21,24H,15-16H2,1-2H3,(H,23,26)/p+1/t21-/m0/s1 |
| InChIKey | KDYRBDIMIJPFEH-NRFANRHFSA-O |
| XLogP | 1.37 |
| TPSA | 92.85 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.53 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |