C15H18N2O5S — CID 51297863
N-(furan-2-ylmethyl)-4-(2-methoxyethylsulfamoyl)benzamide (PubChem CID 51297863) has the molecular formula C15H18N2O5S and a molecular weight of 338.39 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-4-(2-methoxyethylsulfamoyl)benzamide.
| Compound Name | N-(furan-2-ylmethyl)-4-(2-methoxyethylsulfamoyl)benzamide |
|---|---|
| PubChem CID | 51297863 |
| Molecular Formula | C15H18N2O5S |
| Molecular Weight | 338.39 g/mol |
| Exact Mass | 338.09 |
| IUPAC Name | N-(furan-2-ylmethyl)-4-(2-methoxyethylsulfamoyl)benzamide |
| SMILES | COCCNS(=O)(=O)c1ccc(C(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C15H18N2O5S/c1-21-10-8-17-23(19,20)14-6-4-12(5-7-14)15(18)16-11-13-3-2-9-22-13/h2-7,9,17H,8,10-11H2,1H3,(H,16,18) |
| InChIKey | XDBNVBQGWXNMQW-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 97.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.39 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|