C12H12N2O4S — CID 10356308
N-(furan-2-ylmethyl)-4-sulfamoylbenzamide (PubChem CID 10356308) has the molecular formula C12H12N2O4S and a molecular weight of 280.31 g/mol. Its IUPAC name is N-(furan-2-ylmethyl)-4-sulfamoylbenzamide.
| Compound Name | N-(furan-2-ylmethyl)-4-sulfamoylbenzamide |
|---|---|
| PubChem CID | 10356308 |
| Molecular Formula | C12H12N2O4S |
| Molecular Weight | 280.31 g/mol |
| Exact Mass | 280.05 |
| IUPAC Name | N-(furan-2-ylmethyl)-4-sulfamoylbenzamide |
| SMILES | NS(=O)(=O)c1ccc(C(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C12H12N2O4S/c13-19(16,17)11-5-3-9(4-6-11)12(15)14-8-10-2-1-7-18-10/h1-7H,8H2,(H,14,15)(H2,13,16,17) |
| InChIKey | FYPREBIDXQCQJJ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 102.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.31 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |