C13H12N2O3 — CID 27649984
4-N-(furan-2-ylmethyl)benzene-1,4-dicarboxamide (PubChem CID 27649984) has the molecular formula C13H12N2O3 and a molecular weight of 244.25 g/mol. Its IUPAC name is 4-N-(furan-2-ylmethyl)benzene-1,4-dicarboxamide.
| Compound Name | 4-N-(furan-2-ylmethyl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 27649984 |
| Molecular Formula | C13H12N2O3 |
| Molecular Weight | 244.25 g/mol |
| Exact Mass | 244.08 |
| IUPAC Name | 4-N-(furan-2-ylmethyl)benzene-1,4-dicarboxamide |
| SMILES | NC(=O)c1ccc(C(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C13H12N2O3/c14-12(16)9-3-5-10(6-4-9)13(17)15-8-11-2-1-7-18-11/h1-7H,8H2,(H2,14,16)(H,15,17) |
| InChIKey | YSCLYJSNYJIMEF-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 85.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.25 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |