[4-(furan-2-ylmethylcarbamoyl)phenyl]boronic acid;molecular hydrogen

C12H16BNO4 — CID 159533329

IUPAC[4-(furan-2-ylmethylcarbamoyl)phenyl]boronic acid;molecular hydrogen
SMILESO=C(NCc1ccco1)c1ccc(B(O)O)cc1.[H][H].[H][H]
InChIInChI=1S/C12H12BNO4.2H2/c15-12(14-8-11-2-1-7-18-11)9-3-5-10(6-4-9)13(16)17;;/h1-7,16-17H,8H2,(H,14,15);2*1H
InChIKeyMDGWAGGYYFLVRP-UHFFFAOYSA-N
MW249.08 g/mol
LogP0.38
Rot. Bonds4

About [4-(furan-2-ylmethylcarbamoyl)phenyl]boronic acid;molecular hydrogen

[4-(furan-2-ylmethylcarbamoyl)phenyl]boronic acid;molecular hydrogen (PubChem CID 159533329) has the molecular formula C12H16BNO4 and a molecular weight of 249.08 g/mol. Its IUPAC name is [4-(furan-2-ylmethylcarbamoyl)phenyl]boronic acid;molecular hydrogen.

Molecular Properties

Compound Name[4-(furan-2-ylmethylcarbamoyl)phenyl]boronic acid;molecular hydrogen
PubChem CID159533329
Molecular FormulaC12H16BNO4
Molecular Weight249.08 g/mol
Exact Mass249.12
IUPAC Name[4-(furan-2-ylmethylcarbamoyl)phenyl]boronic acid;molecular hydrogen
SMILESO=C(NCc1ccco1)c1ccc(B(O)O)cc1.[H][H].[H][H]
InChIInChI=1S/C12H12BNO4.2H2/c15-12(14-8-11-2-1-7-18-11)9-3-5-10(6-4-9)13(16)17;;/h1-7,16-17H,8H2,(H,14,15);2*1H
InChIKeyMDGWAGGYYFLVRP-UHFFFAOYSA-N
XLogP0.38
TPSA82.70 Ų
H-Bond Donors3
H-Bond Acceptors4
Rotatable Bonds4
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500249.08
LogP ≤ 50.38
H-Bond Donors ≤ 53
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze [4-(furan-2-ylmethylcarbamoyl)phenyl]boronic acid;molecular hydrogen with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of [4-(furan-2-ylmethylcarbamoyl)phenyl]boronic acid;molecular hydrogen?
The IUPAC name of [4-(furan-2-ylmethylcarbamoyl)phenyl]boronic acid;molecular hydrogen (CID 159533329) is [4-(furan-2-ylmethylcarbamoyl)phenyl]boronic acid;molecular hydrogen.
What is the SMILES notation for [4-(furan-2-ylmethylcarbamoyl)phenyl]boronic acid;molecular hydrogen?
The canonical SMILES for [4-(furan-2-ylmethylcarbamoyl)phenyl]boronic acid;molecular hydrogen is O=C(NCc1ccco1)c1ccc(B(O)O)cc1.[H][H].[H][H].
What is the InChIKey of [4-(furan-2-ylmethylcarbamoyl)phenyl]boronic acid;molecular hydrogen?
The InChIKey is MDGWAGGYYFLVRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12BNO4.2H2/c15-12(14-8-11-2-1-7-18-11)9-3-5-10(6-4-9)13(16)17;;/h1-7,16-17H,8H2,(H,14,15);2*1H.
What are the key properties of [4-(furan-2-ylmethylcarbamoyl)phenyl]boronic acid;molecular hydrogen?
[4-(furan-2-ylmethylcarbamoyl)phenyl]boronic acid;molecular hydrogen has a molecular weight of 249.08 g/mol, XLogP of 0.38, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(furan-2-ylmethylcarbamoyl)phenyl]boronic acid;molecular hydrogen is sourced from PubChem (CID 159533329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).