About [4-(furan-2-ylmethylcarbamoyl)phenyl]boronic acid;molecular hydrogen
[4-(furan-2-ylmethylcarbamoyl)phenyl]boronic acid;molecular hydrogen (PubChem CID 159533329) has the molecular formula C12H16BNO4
and a molecular weight of 249.08 g/mol. Its IUPAC name is [4-(furan-2-ylmethylcarbamoyl)phenyl]boronic acid;molecular hydrogen.
Molecular Properties
| Compound Name | [4-(furan-2-ylmethylcarbamoyl)phenyl]boronic acid;molecular hydrogen |
| PubChem CID | 159533329 |
| Molecular Formula | C12H16BNO4 |
| Molecular Weight | 249.08 g/mol |
| Exact Mass | 249.12 |
| IUPAC Name | [4-(furan-2-ylmethylcarbamoyl)phenyl]boronic acid;molecular hydrogen |
| SMILES | O=C(NCc1ccco1)c1ccc(B(O)O)cc1.[H][H].[H][H] |
| InChI | InChI=1S/C12H12BNO4.2H2/c15-12(14-8-11-2-1-7-18-11)9-3-5-10(6-4-9)13(16)17;;/h1-7,16-17H,8H2,(H,14,15);2*1H |
| InChIKey | MDGWAGGYYFLVRP-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 249.08 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze [4-(furan-2-ylmethylcarbamoyl)phenyl]boronic acid;molecular hydrogen with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-(furan-2-ylmethylcarbamoyl)phenyl]boronic acid;molecular hydrogen?
The IUPAC name of [4-(furan-2-ylmethylcarbamoyl)phenyl]boronic acid;molecular hydrogen (CID 159533329) is [4-(furan-2-ylmethylcarbamoyl)phenyl]boronic acid;molecular hydrogen.
What is the SMILES notation for [4-(furan-2-ylmethylcarbamoyl)phenyl]boronic acid;molecular hydrogen?
The canonical SMILES for [4-(furan-2-ylmethylcarbamoyl)phenyl]boronic acid;molecular hydrogen is O=C(NCc1ccco1)c1ccc(B(O)O)cc1.[H][H].[H][H].
What is the InChIKey of [4-(furan-2-ylmethylcarbamoyl)phenyl]boronic acid;molecular hydrogen?
The InChIKey is MDGWAGGYYFLVRP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H12BNO4.2H2/c15-12(14-8-11-2-1-7-18-11)9-3-5-10(6-4-9)13(16)17;;/h1-7,16-17H,8H2,(H,14,15);2*1H.
What are the key properties of [4-(furan-2-ylmethylcarbamoyl)phenyl]boronic acid;molecular hydrogen?
[4-(furan-2-ylmethylcarbamoyl)phenyl]boronic acid;molecular hydrogen has a molecular weight of 249.08 g/mol, XLogP of 0.38, 4 rotatable bonds, 3 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [4-(furan-2-ylmethylcarbamoyl)phenyl]boronic acid;molecular hydrogen is sourced from PubChem (CID 159533329), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).