C19H16N2O3 — CID 109046573
1-N-(furan-2-ylmethyl)-4-N-phenylbenzene-1,4-dicarboxamide (PubChem CID 109046573) has the molecular formula C19H16N2O3 and a molecular weight of 320.35 g/mol. Its IUPAC name is 1-N-(furan-2-ylmethyl)-4-N-phenylbenzene-1,4-dicarboxamide.
| Compound Name | 1-N-(furan-2-ylmethyl)-4-N-phenylbenzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109046573 |
| Molecular Formula | C19H16N2O3 |
| Molecular Weight | 320.35 g/mol |
| Exact Mass | 320.12 |
| IUPAC Name | 1-N-(furan-2-ylmethyl)-4-N-phenylbenzene-1,4-dicarboxamide |
| SMILES | O=C(NCc1ccco1)c1ccc(C(=O)Nc2ccccc2)cc1 |
| InChI | InChI=1S/C19H16N2O3/c22-18(20-13-17-7-4-12-24-17)14-8-10-15(11-9-14)19(23)21-16-5-2-1-3-6-16/h1-12H,13H2,(H,20,22)(H,21,23) |
| InChIKey | XGYCEXXUVOYWGP-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.35 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |