C22H22N2O6 — CID 28638324
N-[4-(furan-2-ylmethylcarbamoyl)phenyl]-3,4,5-trimethoxybenzamide (PubChem CID 28638324) has the molecular formula C22H22N2O6 and a molecular weight of 410.43 g/mol. Its IUPAC name is N-[4-(furan-2-ylmethylcarbamoyl)phenyl]-3,4,5-trimethoxybenzamide.
| Compound Name | N-[4-(furan-2-ylmethylcarbamoyl)phenyl]-3,4,5-trimethoxybenzamide |
|---|---|
| PubChem CID | 28638324 |
| Molecular Formula | C22H22N2O6 |
| Molecular Weight | 410.43 g/mol |
| Exact Mass | 410.15 |
| IUPAC Name | N-[4-(furan-2-ylmethylcarbamoyl)phenyl]-3,4,5-trimethoxybenzamide |
| SMILES | COc1cc(C(=O)Nc2ccc(C(=O)NCc3ccco3)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C22H22N2O6/c1-27-18-11-15(12-19(28-2)20(18)29-3)22(26)24-16-8-6-14(7-9-16)21(25)23-13-17-5-4-10-30-17/h4-12H,13H2,1-3H3,(H,23,25)(H,24,26) |
| InChIKey | QKIYDUQUEDKSNK-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 99.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.43 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |