C21H20N2O5 — CID 109046619
4-N-(2,5-dimethoxyphenyl)-1-N-(furan-2-ylmethyl)benzene-1,4-dicarboxamide (PubChem CID 109046619) has the molecular formula C21H20N2O5 and a molecular weight of 380.40 g/mol. Its IUPAC name is 4-N-(2,5-dimethoxyphenyl)-1-N-(furan-2-ylmethyl)benzene-1,4-dicarboxamide.
| Compound Name | 4-N-(2,5-dimethoxyphenyl)-1-N-(furan-2-ylmethyl)benzene-1,4-dicarboxamide |
|---|---|
| PubChem CID | 109046619 |
| Molecular Formula | C21H20N2O5 |
| Molecular Weight | 380.40 g/mol |
| Exact Mass | 380.14 |
| IUPAC Name | 4-N-(2,5-dimethoxyphenyl)-1-N-(furan-2-ylmethyl)benzene-1,4-dicarboxamide |
| SMILES | COc1ccc(OC)c(NC(=O)c2ccc(C(=O)NCc3ccco3)cc2)c1 |
| InChI | InChI=1S/C21H20N2O5/c1-26-16-9-10-19(27-2)18(12-16)23-21(25)15-7-5-14(6-8-15)20(24)22-13-17-4-3-11-28-17/h3-12H,13H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | VUUQWCPKXKDLSC-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.40 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |