C20H17N3O5 — CID 109104940
methyl 4-[[5-(furan-2-ylmethylcarbamoyl)pyridine-3-carbonyl]amino]benzoate (PubChem CID 109104940) has the molecular formula C20H17N3O5 and a molecular weight of 379.37 g/mol. Its IUPAC name is methyl 4-[[5-(furan-2-ylmethylcarbamoyl)pyridine-3-carbonyl]amino]benzoate.
| Compound Name | methyl 4-[[5-(furan-2-ylmethylcarbamoyl)pyridine-3-carbonyl]amino]benzoate |
|---|---|
| PubChem CID | 109104940 |
| Molecular Formula | C20H17N3O5 |
| Molecular Weight | 379.37 g/mol |
| Exact Mass | 379.12 |
| IUPAC Name | methyl 4-[[5-(furan-2-ylmethylcarbamoyl)pyridine-3-carbonyl]amino]benzoate |
| SMILES | COC(=O)c1ccc(NC(=O)c2cncc(C(=O)NCc3ccco3)c2)cc1 |
| InChI | InChI=1S/C20H17N3O5/c1-27-20(26)13-4-6-16(7-5-13)23-19(25)15-9-14(10-21-11-15)18(24)22-12-17-3-2-8-28-17/h2-11H,12H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | MLGSMPZLLNWJLF-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 110.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.37 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |