C19H18N4O5 — CID 19398212
methyl 4-[[5-(furan-2-ylmethylcarbamoyl)-1-methylpyrazol-4-yl]carbamoyl]benzoate (PubChem CID 19398212) has the molecular formula C19H18N4O5 and a molecular weight of 382.38 g/mol. Its IUPAC name is methyl 4-[[5-(furan-2-ylmethylcarbamoyl)-1-methylpyrazol-4-yl]carbamoyl]benzoate.
| Compound Name | methyl 4-[[5-(furan-2-ylmethylcarbamoyl)-1-methylpyrazol-4-yl]carbamoyl]benzoate |
|---|---|
| PubChem CID | 19398212 |
| Molecular Formula | C19H18N4O5 |
| Molecular Weight | 382.38 g/mol |
| Exact Mass | 382.13 |
| IUPAC Name | methyl 4-[[5-(furan-2-ylmethylcarbamoyl)-1-methylpyrazol-4-yl]carbamoyl]benzoate |
| SMILES | COC(=O)c1ccc(C(=O)Nc2cnn(C)c2C(=O)NCc2ccco2)cc1 |
| InChI | InChI=1S/C19H18N4O5/c1-23-16(18(25)20-10-14-4-3-9-28-14)15(11-21-23)22-17(24)12-5-7-13(8-6-12)19(26)27-2/h3-9,11H,10H2,1-2H3,(H,20,25)(H,22,24) |
| InChIKey | SNNOYRGTKJIJBK-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 115.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.38 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |